C21H26N4O7S — CID 24531382
[2-[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 24531382) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is [2-[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [2-[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24531382 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [2-[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(NC(=O)COC(=O)c3cc([N+](=O)[O-])cn3C)cc2)C1 |
| InChI | InChI=1S/C21H26N4O7S/c1-14-8-15(2)11-24(10-14)33(30,31)18-6-4-16(5-7-18)22-20(26)13-32-21(27)19-9-17(25(28)29)12-23(19)3/h4-7,9,12,14-15H,8,10-11,13H2,1-3H3,(H,22,26) |
| InChIKey | JHCDQRDMGSLRRN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|