C22H26FN3O5S — CID 27998227
[2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 27998227) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27998227 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | [2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NC(=O)COC(=O)c3ccc(F)cc3N)cc2)C1 |
| InChI | InChI=1S/C22H26FN3O5S/c1-14-9-15(2)12-26(11-14)32(29,30)18-6-4-17(5-7-18)25-21(27)13-31-22(28)19-8-3-16(23)10-20(19)24/h3-8,10,14-15H,9,11-13,24H2,1-2H3,(H,25,27)/t14-,15+ |
| InChIKey | JWYUSHNIFLYGNH-GASCZTMLSA-N |
| XLogP | 2.87 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|