C20H22F2N2O3S — CID 43030164
N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2,5-difluorobenzamide (PubChem CID 43030164) has the molecular formula C20H22F2N2O3S and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 43030164 |
| Molecular Formula | C20H22F2N2O3S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2,5-difluorobenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(NC(=O)c3cc(F)ccc3F)cc2)C1 |
| InChI | InChI=1S/C20H22F2N2O3S/c1-13-9-14(2)12-24(11-13)28(26,27)17-6-4-16(5-7-17)23-20(25)18-10-15(21)3-8-19(18)22/h3-8,10,13-14H,9,11-12H2,1-2H3,(H,23,25) |
| InChIKey | LXOVXQWWQUTILH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |