C21H31FN2O3S — CID 4621990
N-cycloheptyl-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzamide (PubChem CID 4621990) has the molecular formula C21H31FN2O3S and a molecular weight of 410.56 g/mol. Its IUPAC name is N-cycloheptyl-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzamide.
| Compound Name | N-cycloheptyl-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 4621990 |
| Molecular Formula | C21H31FN2O3S |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-cycloheptyl-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluorobenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(F)c(C(=O)NC3CCCCCC3)c2)C1 |
| InChI | InChI=1S/C21H31FN2O3S/c1-15-11-16(2)14-24(13-15)28(26,27)18-9-10-20(22)19(12-18)21(25)23-17-7-5-3-4-6-8-17/h9-10,12,15-17H,3-8,11,13-14H2,1-2H3,(H,23,25) |
| InChIKey | YKLBHWYHYYIVMY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |