C21H32FN3O4S — CID 126479356
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluoro-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 126479356) has the molecular formula C21H32FN3O4S and a molecular weight of 441.57 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluoro-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluoro-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 126479356 |
| Molecular Formula | C21H32FN3O4S |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-fluoro-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(F)c(C(=O)NCCCN3CCOCC3)c2)C1 |
| InChI | InChI=1S/C21H32FN3O4S/c1-16-12-17(2)15-25(14-16)30(27,28)18-4-5-20(22)19(13-18)21(26)23-6-3-7-24-8-10-29-11-9-24/h4-5,13,16-17H,3,6-12,14-15H2,1-2H3,(H,23,26) |
| InChIKey | KEJLCPJZJSZTIF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|