C27H36BrN3O4S2 — CID 92907011
2-(4-bromophenyl)sulfanyl-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 92907011) has the molecular formula C27H36BrN3O4S2 and a molecular weight of 610.64 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 92907011 |
| Molecular Formula | C27H36BrN3O4S2 |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(Sc3ccc(Br)cc3)c(C(=O)NCCCN3CCOCC3)c2)C1 |
| InChI | InChI=1S/C27H36BrN3O4S2/c1-20-16-21(2)19-31(18-20)37(33,34)24-8-9-26(36-23-6-4-22(28)5-7-23)25(17-24)27(32)29-10-3-11-30-12-14-35-15-13-30/h4-9,17,20-21H,3,10-16,18-19H2,1-2H3,(H,29,32)/t20-,21+ |
| InChIKey | CPGYULRSFPEHBZ-OYRHEFFESA-N |
| XLogP | 4.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|