C24H31FN2O5S2 — CID 92695074
N-(2,2-dimethoxyethyl)-5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-(4-fluorophenyl)sulfanylbenzamide (PubChem CID 92695074) has the molecular formula C24H31FN2O5S2 and a molecular weight of 510.65 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-(4-fluorophenyl)sulfanylbenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-(4-fluorophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 92695074 |
| Molecular Formula | C24H31FN2O5S2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-(4-fluorophenyl)sulfanylbenzamide |
| SMILES | COC(CNC(=O)c1cc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)ccc1Sc1ccc(F)cc1)OC |
| InChI | InChI=1S/C24H31FN2O5S2/c1-16-11-17(2)15-27(14-16)34(29,30)20-9-10-22(33-19-7-5-18(25)6-8-19)21(12-20)24(28)26-13-23(31-3)32-4/h5-10,12,16-17,23H,11,13-15H2,1-4H3,(H,26,28)/t16-,17-/m0/s1 |
| InChIKey | IMJXPIWZVCTFBU-IRXDYDNUSA-N |
| XLogP | 3.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|