C27H37BrN2O3S2 — CID 98362955
2-(4-bromophenyl)sulfanyl-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-heptylbenzamide (PubChem CID 98362955) has the molecular formula C27H37BrN2O3S2 and a molecular weight of 581.64 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-heptylbenzamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-heptylbenzamide |
|---|---|
| PubChem CID | 98362955 |
| Molecular Formula | C27H37BrN2O3S2 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-heptylbenzamide |
| SMILES | CCCCCCCNC(=O)c1cc(S(=O)(=O)N2C[C@H](C)C[C@@H](C)C2)ccc1Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H37BrN2O3S2/c1-4-5-6-7-8-15-29-27(31)25-17-24(35(32,33)30-18-20(2)16-21(3)19-30)13-14-26(25)34-23-11-9-22(28)10-12-23/h9-14,17,20-21H,4-8,15-16,18-19H2,1-3H3,(H,29,31)/t20-,21-/m1/s1 |
| InChIKey | SXLKKNQEXLJICU-NHCUHLMSSA-N |
| XLogP | 6.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|