C24H29FN2O4S2 — CID 3318997
N-cycloheptyl-2-(4-fluorophenyl)sulfanyl-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 3318997) has the molecular formula C24H29FN2O4S2 and a molecular weight of 492.64 g/mol. Its IUPAC name is N-cycloheptyl-2-(4-fluorophenyl)sulfanyl-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-cycloheptyl-2-(4-fluorophenyl)sulfanyl-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3318997 |
| Molecular Formula | C24H29FN2O4S2 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-cycloheptyl-2-(4-fluorophenyl)sulfanyl-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NC1CCCCCC1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FN2O4S2/c25-18-7-9-20(10-8-18)32-23-12-11-21(33(29,30)27-13-15-31-16-14-27)17-22(23)24(28)26-19-5-3-1-2-4-6-19/h7-12,17,19H,1-6,13-16H2,(H,26,28) |
| InChIKey | RLAQIRCLJOWTFV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |