C26H33N3O4S — CID 16548323
N-cyclopentyl-2-[[3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]benzamide (PubChem CID 16548323) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is N-cyclopentyl-2-[[3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]benzamide |
|---|---|
| PubChem CID | 16548323 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-cyclopentyl-2-[[3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]amino]benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Nc3ccccc3C(=O)NC3CCCC3)c2)C1 |
| InChI | InChI=1S/C26H33N3O4S/c1-18-14-19(2)17-29(16-18)34(32,33)22-11-7-8-20(15-22)25(30)28-24-13-6-5-12-23(24)26(31)27-21-9-3-4-10-21/h5-8,11-13,15,18-19,21H,3-4,9-10,14,16-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | GSVFNGXBPPCSJL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |