C20H30N2O3S — CID 109065250
N-cycloheptyl-3-(3-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 109065250) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-cycloheptyl-3-(3-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-cycloheptyl-3-(3-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 109065250 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-cycloheptyl-3-(3-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(C(=O)NC3CCCCCC3)c2)C1 |
| InChI | InChI=1S/C20H30N2O3S/c1-16-8-7-13-22(15-16)26(24,25)19-12-6-9-17(14-19)20(23)21-18-10-4-2-3-5-11-18/h6,9,12,14,16,18H,2-5,7-8,10-11,13,15H2,1H3,(H,21,23) |
| InChIKey | XZTLCACYYRIZCO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |