C18H23N5O5S — CID 51648542
N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(4-nitroimidazol-1-yl)acetamide (PubChem CID 51648542) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(4-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(4-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 51648542 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(4-nitroimidazol-1-yl)acetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NC(=O)Cn3cnc([N+](=O)[O-])c3)cc2)C1 |
| InChI | InChI=1S/C18H23N5O5S/c1-13-7-14(2)9-22(8-13)29(27,28)16-5-3-15(4-6-16)20-18(24)11-21-10-17(19-12-21)23(25)26/h3-6,10,12-14H,7-9,11H2,1-2H3,(H,20,24)/t13-,14+ |
| InChIKey | VSOASVVHGUGPHS-OKILXGFUSA-N |
| XLogP | 2.10 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|