C19H26N4O5S — CID 27890730
N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 27890730) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 27890730 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(NC(=O)CN3C(=O)CN(C)C3=O)cc2)C1 |
| InChI | InChI=1S/C19H26N4O5S/c1-13-8-14(2)10-22(9-13)29(27,28)16-6-4-15(5-7-16)20-17(24)11-23-18(25)12-21(3)19(23)26/h4-7,13-14H,8-12H2,1-3H3,(H,20,24)/t13-,14-/m1/s1 |
| InChIKey | ZFBKXXGMBDGVLE-ZIAGYGMSSA-N |
| XLogP | 1.19 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|