C13H16N4O5S — CID 9188385
2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(methylsulfamoyl)phenyl]acetamide (PubChem CID 9188385) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(methylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(methylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9188385 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(methylsulfamoyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)CN2C(=O)CN(C)C2=O)cc1 |
| InChI | InChI=1S/C13H16N4O5S/c1-14-23(21,22)10-5-3-9(4-6-10)15-11(18)7-17-12(19)8-16(2)13(17)20/h3-6,14H,7-8H2,1-2H3,(H,15,18) |
| InChIKey | ZAXSNOJSLYBLJR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|