C20H26FN5O4 — CID 9405113
N-(4-fluorophenyl)-2-[4-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]piperazin-1-yl]acetamide (PubChem CID 9405113) has the molecular formula C20H26FN5O4 and a molecular weight of 419.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9405113 |
| Molecular Formula | C20H26FN5O4 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]piperazin-1-yl]acetamide |
| SMILES | CN1CC(=O)N(CCCC(=O)N2CCN(CC(=O)Nc3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C20H26FN5O4/c1-23-14-19(29)26(20(23)30)8-2-3-18(28)25-11-9-24(10-12-25)13-17(27)22-16-6-4-15(21)5-7-16/h4-7H,2-3,8-14H2,1H3,(H,22,27) |
| InChIKey | NTHLPCLMSKQSPD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|