C19H25FN4O5S — CID 55434992
3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione (PubChem CID 55434992) has the molecular formula C19H25FN4O5S and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55434992 |
| Molecular Formula | C19H25FN4O5S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CCCC(=O)N2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C19H25FN4O5S/c1-21-14-18(26)24(19(21)27)11-2-4-17(25)22-9-3-10-23(13-12-22)30(28,29)16-7-5-15(20)6-8-16/h5-8H,2-4,9-14H2,1H3 |
| InChIKey | RVLHMQWEIFMPFQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|