C15H18N2O5S — CID 75392488
2-(4-methyl-2,6-dioxopiperidin-1-yl)-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 75392488) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(4-methyl-2,6-dioxopiperidin-1-yl)-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-methyl-2,6-dioxopiperidin-1-yl)-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 75392488 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(4-methyl-2,6-dioxopiperidin-1-yl)-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CC1CC(=O)N(CC(=O)Nc2ccc(S(C)(=O)=O)cc2)C(=O)C1 |
| InChI | InChI=1S/C15H18N2O5S/c1-10-7-14(19)17(15(20)8-10)9-13(18)16-11-3-5-12(6-4-11)23(2,21)22/h3-6,10H,7-9H2,1-2H3,(H,16,18) |
| InChIKey | RGCYQGUTWDAHBF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|