C14H13N3O3 — CID 61238107
N-(4-cyanophenyl)-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 61238107) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-(4-cyanophenyl)-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 61238107 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(4-cyanophenyl)-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | CC1CC(=O)N(CC(=O)Nc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C14H13N3O3/c1-9-6-13(19)17(14(9)20)8-12(18)16-11-4-2-10(7-15)3-5-11/h2-5,9H,6,8H2,1H3,(H,16,18) |
| InChIKey | JFCMUKNHTRSWBH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|