C24H33N3O5S — CID 24501053
N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetamide (PubChem CID 24501053) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetamide |
|---|---|
| PubChem CID | 24501053 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(NC(=O)CN3C(=O)CC4(CCCCC4)C3=O)cc2)C1 |
| InChI | InChI=1S/C24H33N3O5S/c1-17-12-18(2)15-26(14-17)33(31,32)20-8-6-19(7-9-20)25-21(28)16-27-22(29)13-24(23(27)30)10-4-3-5-11-24/h6-9,17-18H,3-5,10-16H2,1-2H3,(H,25,28) |
| InChIKey | YTLXQFYOCYMBIG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|