C23H32N4O5S — CID 43027565
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]acetamide (PubChem CID 43027565) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 43027565 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(NC(=O)CN3C(=O)N(C)C4(CCCCC4)C3=O)cc2)C1 |
| InChI | InChI=1S/C23H32N4O5S/c1-17-7-6-14-26(15-17)33(31,32)19-10-8-18(9-11-19)24-20(28)16-27-21(29)23(25(2)22(27)30)12-4-3-5-13-23/h8-11,17H,3-7,12-16H2,1-2H3,(H,24,28) |
| InChIKey | AGVMFQLXZSXVPV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|