C16H16ClN3O7 — CID 18128468
[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 18128468) has the molecular formula C16H16ClN3O7 and a molecular weight of 397.77 g/mol. Its IUPAC name is [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18128468 |
| Molecular Formula | C16H16ClN3O7 |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | COc1cc(OC)c(NC(=O)COC(=O)c2cc([N+](=O)[O-])cn2C)cc1Cl |
| InChI | InChI=1S/C16H16ClN3O7/c1-19-7-9(20(23)24)4-12(19)16(22)27-8-15(21)18-11-5-10(17)13(25-2)6-14(11)26-3/h4-7H,8H2,1-3H3,(H,18,21) |
| InChIKey | QFKUZSOPYYVIMD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|