C23H23N3O7 — CID 24531354
[2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 24531354) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24531354 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | COc1ccc(C(NC(=O)COC(=O)c2cc([N+](=O)[O-])cn2C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O7/c1-25-13-17(26(29)30)12-20(25)23(28)33-14-21(27)24-22(15-4-8-18(31-2)9-5-15)16-6-10-19(32-3)11-7-16/h4-13,22H,14H2,1-3H3,(H,24,27) |
| InChIKey | LAJQYQLZGMDXCF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|