C27H29NO7 — CID 27722315
[2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate (PubChem CID 27722315) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 27722315 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC(c2ccc(OC)cc2)c2ccc(OC)cc2)ccc1OC |
| InChI | InChI=1S/C27H29NO7/c1-5-34-24-16-20(10-15-23(24)33-4)27(30)35-17-25(29)28-26(18-6-11-21(31-2)12-7-18)19-8-13-22(32-3)14-9-19/h6-16,26H,5,17H2,1-4H3,(H,28,29) |
| InChIKey | BGZGYTOEXUBLAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |