C15H13NO6S2 — CID 3519185
(2-oxooxolan-3-yl) 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 3519185) has the molecular formula C15H13NO6S2 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (2-oxooxolan-3-yl) 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 3519185 |
| Molecular Formula | C15H13NO6S2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | (2-oxooxolan-3-yl) 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(OC1CCOC1=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H13NO6S2/c17-14(22-12-7-8-21-15(12)18)10-3-5-11(6-4-10)16-24(19,20)13-2-1-9-23-13/h1-6,9,12,16H,7-8H2 |
| InChIKey | GBQLSBAZEMYALU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |