C20H25N3O4S2 — CID 55349251
N-[4-[4-(oxolan-2-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide (PubChem CID 55349251) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[4-[4-(oxolan-2-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[4-(oxolan-2-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55349251 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[4-[4-(oxolan-2-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccs2)cc1)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C20H25N3O4S2/c24-20(23-11-9-22(10-12-23)15-18-3-1-13-27-18)16-5-7-17(8-6-16)21-29(25,26)19-4-2-14-28-19/h2,4-8,14,18,21H,1,3,9-13,15H2 |
| InChIKey | XRQDGYZFATVSTC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |