C20H21N3O6S4 — CID 2336673
N-[[(2S)-oxolan-2-yl]methyl]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2336673) has the molecular formula C20H21N3O6S4 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2336673 |
| Molecular Formula | C20H21N3O6S4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H21N3O6S4/c24-20(21-13-17-4-1-7-29-17)14-10-15(22-32(25,26)18-5-2-8-30-18)12-16(11-14)23-33(27,28)19-6-3-9-31-19/h2-3,5-6,8-12,17,22-23H,1,4,7,13H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | UGYLAHLAVMTMAC-KRWDZBQOSA-N |
| XLogP | 3.32 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |