C10H12ClNO4S2 — CID 65368622
4-(oxolan-2-ylmethylcarbamoyl)thiophene-2-sulfonyl chloride (PubChem CID 65368622) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethylcarbamoyl)thiophene-2-sulfonyl chloride.
| Compound Name | 4-(oxolan-2-ylmethylcarbamoyl)thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65368622 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-(oxolan-2-ylmethylcarbamoyl)thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCC1CCCO1)c1csc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H12ClNO4S2/c11-18(14,15)9-4-7(6-17-9)10(13)12-5-8-2-1-3-16-8/h4,6,8H,1-3,5H2,(H,12,13) |
| InChIKey | GCSDJLVHPUNQHG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |