C14H14N2O3S2 — CID 7635774
N-[4-(2-oxopyrrolidin-1-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 7635774) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[4-(2-oxopyrrolidin-1-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7635774 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=C1CCCN1c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O3S2/c17-13-3-1-9-16(13)12-7-5-11(6-8-12)15-21(18,19)14-4-2-10-20-14/h2,4-8,10,15H,1,3,9H2 |
| InChIKey | NLYRLIWDUDGJNH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |