C17H18N2O3S — CID 7636091
N-[4-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 7636091) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[4-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7636091 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[4-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1CCCCN1c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c20-17-8-4-5-13-19(17)15-11-9-14(10-12-15)18-23(21,22)16-6-2-1-3-7-16/h1-3,6-7,9-12,18H,4-5,8,13H2 |
| InChIKey | SZCYNRJZVDPVID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |