C26H23N3O5S2 — CID 99955062
N-naphthalen-1-yl-4-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]benzenesulfonamide (PubChem CID 99955062) has the molecular formula C26H23N3O5S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-naphthalen-1-yl-4-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | N-naphthalen-1-yl-4-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 99955062 |
| Molecular Formula | C26H23N3O5S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-naphthalen-1-yl-4-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]benzenesulfonamide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O5S2/c30-26-9-4-18-29(26)21-12-16-23(17-13-21)35(31,32)27-20-10-14-22(15-11-20)36(33,34)28-25-8-3-6-19-5-1-2-7-24(19)25/h1-3,5-8,10-17,27-28H,4,9,18H2 |
| InChIKey | FBWKZFUQXFAWKN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |