C23H20N2O4S — CID 58664932
N-(2-benzoylphenyl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 58664932) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-(2-benzoylphenyl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58664932 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-(2-benzoylphenyl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | O=C(c1ccccc1)c1ccccc1NS(=O)(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H20N2O4S/c26-22-11-6-16-25(22)18-12-14-19(15-13-18)30(28,29)24-21-10-5-4-9-20(21)23(27)17-7-2-1-3-8-17/h1-5,7-10,12-15,24H,6,11,16H2 |
| InChIKey | GVKSHCBASMBUPR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|