C15H18N2O4S3 — CID 1092315
N-(4-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide (PubChem CID 1092315) has the molecular formula C15H18N2O4S3 and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(4-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 1092315 |
| Molecular Formula | C15H18N2O4S3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-(4-piperidin-1-ylsulfonylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C15H18N2O4S3/c18-23(19,15-5-4-12-22-15)16-13-6-8-14(9-7-13)24(20,21)17-10-2-1-3-11-17/h4-9,12,16H,1-3,10-11H2 |
| InChIKey | LAXSHVLQKGTZOC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |