C18H21ClN2O4S2 — CID 19684562
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chlorobenzenesulfonamide (PubChem CID 19684562) has the molecular formula C18H21ClN2O4S2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 19684562 |
| Molecular Formula | C18H21ClN2O4S2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O4S2/c19-15-5-9-17(10-6-15)26(22,23)20-16-7-11-18(12-8-16)27(24,25)21-13-3-1-2-4-14-21/h5-12,20H,1-4,13-14H2 |
| InChIKey | VIOHUBXOFAKBRF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |