C18H20ClFN2O4S2 — CID 60532477
N-[4-(azepan-1-ylsulfonyl)phenyl]-3-chloro-2-fluorobenzenesulfonamide (PubChem CID 60532477) has the molecular formula C18H20ClFN2O4S2 and a molecular weight of 446.95 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-3-chloro-2-fluorobenzenesulfonamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3-chloro-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60532477 |
| Molecular Formula | C18H20ClFN2O4S2 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3-chloro-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C18H20ClFN2O4S2/c19-16-6-5-7-17(18(16)20)27(23,24)21-14-8-10-15(11-9-14)28(25,26)22-12-3-1-2-4-13-22/h5-11,21H,1-4,12-13H2 |
| InChIKey | BLBCWXFRMUGFPJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |