C21H15N3O4 — CID 102286988
(2,5-dioxopyrrolidin-1-yl) 4-(6-pyridin-2-yl-3-pyridinyl)benzoate (PubChem CID 102286988) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(6-pyridin-2-yl-3-pyridinyl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(6-pyridin-2-yl-3-pyridinyl)benzoate |
|---|---|
| PubChem CID | 102286988 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(6-pyridin-2-yl-3-pyridinyl)benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(-c2ccc(-c3ccccn3)nc2)cc1 |
| InChI | InChI=1S/C21H15N3O4/c25-19-10-11-20(26)24(19)28-21(27)15-6-4-14(5-7-15)16-8-9-18(23-13-16)17-3-1-2-12-22-17/h1-9,12-13H,10-11H2 |
| InChIKey | XNYRYLRNKGXNPW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|