C25H19N5O5 — CID 14970918
(1Z)-4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-N-(3-methylbenzotriazol-3-ium-1-yl)benzenecarboximidate (PubChem CID 14970918) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is (1Z)-4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-N-(3-methylbenzotriazol-3-ium-1-yl)benzenecarboximidate.
| Compound Name | (1Z)-4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-N-(3-methylbenzotriazol-3-ium-1-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 14970918 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (1Z)-4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-N-(3-methylbenzotriazol-3-ium-1-yl)benzenecarboximidate |
| SMILES | C[n+]1nn(/N=C(\[O-])c2ccc(-c3ccc(C(=O)ON4C(=O)CCC4=O)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H19N5O5/c1-28-20-4-2-3-5-21(20)30(27-28)26-24(33)18-10-6-16(7-11-18)17-8-12-19(13-9-17)25(34)35-29-22(31)14-15-23(29)32/h2-13H,14-15H2,1H3 |
| InChIKey | XHDAEJCTYLQFBV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|