C15H16N4O4 — CID 10805345
(2,5-dioxopyrrolidin-1-yl) 4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 10805345) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 10805345 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(/N=N/N2CCCC2)cc1 |
| InChI | InChI=1S/C15H16N4O4/c20-13-7-8-14(21)19(13)23-15(22)11-3-5-12(6-4-11)16-17-18-9-1-2-10-18/h3-6H,1-2,7-10H2/b17-16+ |
| InChIKey | JVHDUIRIHXZBNJ-WUKNDPDISA-N |
| XLogP | 2.00 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|