C10H8N2O5 — CID 50739417
(2,5-dioxopyrrolidin-1-yl) 1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 50739417) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 50739417 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C10H8N2O5/c13-8-3-4-9(14)12(8)17-10(15)7-2-1-5-11(16)6-7/h1-2,5-6H,3-4H2 |
| InChIKey | KGFXPTIVQOBCJS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 90.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|