C11H8AtNO4 — CID 15341491
[3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]astatine (PubChem CID 15341491) has the molecular formula C11H8AtNO4 and a molecular weight of 428.19 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]astatine.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]astatine |
|---|---|
| PubChem CID | 15341491 |
| Molecular Formula | C11H8AtNO4 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]astatine |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cccc([At])c1 |
| InChI | InChI=1S/C11H8AtNO4/c12-8-3-1-2-7(6-8)11(16)17-13-9(14)4-5-10(13)15/h1-3,6H,4-5H2 |
| InChIKey | DJSMAEQVNQHSAD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|