C15H13N3O6 — CID 175661840
(2,5-dioxopyrrolidin-1-yl) 3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate (PubChem CID 175661840) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate |
|---|---|
| PubChem CID | 175661840 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(2,4-dioxo-1,3-diazinan-1-yl)benzoate |
| SMILES | O=C1CCN(c2cccc(C(=O)ON3C(=O)CCC3=O)c2)C(=O)N1 |
| InChI | InChI=1S/C15H13N3O6/c19-11-6-7-17(15(23)16-11)10-3-1-2-9(8-10)14(22)24-18-12(20)4-5-13(18)21/h1-3,8H,4-7H2,(H,16,19,23) |
| InChIKey | ASEFBXNWYAYHMN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|