C12H12N4O4 — CID 12925763
(2,5-dioxopyrrolidin-1-yl) 3-(diaminomethylideneamino)benzoate (PubChem CID 12925763) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(diaminomethylideneamino)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 12925763 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1cccc(C(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C12H12N4O4/c13-12(14)15-8-3-1-2-7(6-8)11(19)20-16-9(17)4-5-10(16)18/h1-3,6H,4-5H2,(H4,13,14,15) |
| InChIKey | TZMGGIPLDLURRW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|