C20H18N4O4S — CID 168613227
(2,5-dioxopyrrolidin-1-yl) 3-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]benzoate (PubChem CID 168613227) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 168613227 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]benzoate |
| SMILES | NC(=NN=Cc1cccc(C(=O)ON2C(=O)CCC2=O)c1)SCc1ccccc1 |
| InChI | InChI=1S/C20H18N4O4S/c21-20(29-13-14-5-2-1-3-6-14)23-22-12-15-7-4-8-16(11-15)19(27)28-24-17(25)9-10-18(24)26/h1-8,11-12H,9-10,13H2,(H2,21,23) |
| InChIKey | ROOLAULRHHWYHM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|