C15H14ClN3S — CID 71591151
(3-chlorophenyl)methyl N'-[(E)-benzylideneamino]carbamimidothioate (PubChem CID 71591151) has the molecular formula C15H14ClN3S and a molecular weight of 303.82 g/mol. Its IUPAC name is (3-chlorophenyl)methyl N'-[(E)-benzylideneamino]carbamimidothioate.
| Compound Name | (3-chlorophenyl)methyl N'-[(E)-benzylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 71591151 |
| Molecular Formula | C15H14ClN3S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (3-chlorophenyl)methyl N'-[(E)-benzylideneamino]carbamimidothioate |
| SMILES | N/C(=N\N=C\c1ccccc1)SCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14ClN3S/c16-14-8-4-7-13(9-14)11-20-15(17)19-18-10-12-5-2-1-3-6-12/h1-10H,11H2,(H2,17,19)/b18-10+ |
| InChIKey | SEWPYMXYIXDNMU-VCHYOVAHSA-N |
| XLogP | 3.92 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|