C19H22Cl2N4S — CID 168601273
benzyl N'-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168601273) has the molecular formula C19H22Cl2N4S and a molecular weight of 409.39 g/mol. Its IUPAC name is benzyl N'-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168601273 |
| Molecular Formula | C19H22Cl2N4S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | benzyl N'-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(N(CCCl)CCCl)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C19H22Cl2N4S/c20-10-12-25(13-11-21)18-8-6-16(7-9-18)14-23-24-19(22)26-15-17-4-2-1-3-5-17/h1-9,14H,10-13,15H2,(H2,22,24) |
| InChIKey | YALTXRWZYCMNEV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|