C25H28N4S — CID 168611322
benzyl N'-[[4-(N-butylanilino)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168611322) has the molecular formula C25H28N4S and a molecular weight of 416.59 g/mol. Its IUPAC name is benzyl N'-[[4-(N-butylanilino)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-(N-butylanilino)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611322 |
| Molecular Formula | C25H28N4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | benzyl N'-[[4-(N-butylanilino)phenyl]methylideneamino]carbamimidothioate |
| SMILES | CCCCN(c1ccccc1)c1ccc(C=NN=C(N)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N4S/c1-2-3-18-29(23-12-8-5-9-13-23)24-16-14-21(15-17-24)19-27-28-25(26)30-20-22-10-6-4-7-11-22/h4-17,19H,2-3,18,20H2,1H3,(H2,26,28) |
| InChIKey | MONHRUAFPREPHL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|