C23H23N3OS — CID 168612342
benzyl N'-[[4-(2-phenylethoxy)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612342) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is benzyl N'-[[4-(2-phenylethoxy)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-(2-phenylethoxy)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612342 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | benzyl N'-[[4-(2-phenylethoxy)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(OCCc2ccccc2)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C23H23N3OS/c24-23(28-18-21-9-5-2-6-10-21)26-25-17-20-11-13-22(14-12-20)27-16-15-19-7-3-1-4-8-19/h1-14,17H,15-16,18H2,(H2,24,26) |
| InChIKey | LPNGKTDXZJABRV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|