C16H16FN3OS — CID 91970358
(4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 91970358) has the molecular formula C16H16FN3OS and a molecular weight of 317.39 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 91970358 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(C=N/N=C(\N)SCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FN3OS/c1-21-15-8-4-12(5-9-15)10-19-20-16(18)22-11-13-2-6-14(17)7-3-13/h2-10H,11H2,1H3,(H2,18,20) |
| InChIKey | XWPJVDRXXYMZCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|