C23H21FN4O2S — CID 135706609
(4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]-N-(phenylcarbamoyl)carbamimidothioate (PubChem CID 135706609) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]-N-(phenylcarbamoyl)carbamimidothioate.
| Compound Name | (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]-N-(phenylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 135706609 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (4-fluorophenyl)methyl N'-[(4-methoxyphenyl)methylideneamino]-N-(phenylcarbamoyl)carbamimidothioate |
| SMILES | COc1ccc(C=N/N=C(/NC(=O)Nc2ccccc2)SCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN4O2S/c1-30-21-13-9-17(10-14-21)15-25-28-23(31-16-18-7-11-19(24)12-8-18)27-22(29)26-20-5-3-2-4-6-20/h2-15H,16H2,1H3,(H2,26,27,28,29) |
| InChIKey | HRPIWMDRJKDSQV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|