C25H22FN3O2S — CID 40972053
(2Z,5R)-3-benzyl-5-[(4-fluorophenyl)methyl]-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 40972053) has the molecular formula C25H22FN3O2S and a molecular weight of 447.54 g/mol. Its IUPAC name is (2Z,5R)-3-benzyl-5-[(4-fluorophenyl)methyl]-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-3-benzyl-5-[(4-fluorophenyl)methyl]-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40972053 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2Z,5R)-3-benzyl-5-[(4-fluorophenyl)methyl]-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=N\N=C2/S[C@H](Cc3ccc(F)cc3)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22FN3O2S/c1-31-22-13-9-19(10-14-22)16-27-28-25-29(17-20-5-3-2-4-6-20)24(30)23(32-25)15-18-7-11-21(26)12-8-18/h2-14,16,23H,15,17H2,1H3/b27-16-,28-25-/t23-/m1/s1 |
| InChIKey | RVQQFBBLHMORSP-PWZMAKNSSA-N |
| XLogP | 4.91 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|