C22H17ClFN3O2S — CID 98147162
(2Z,5R)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 98147162) has the molecular formula C22H17ClFN3O2S and a molecular weight of 441.92 g/mol. Its IUPAC name is (2Z,5R)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98147162 |
| Molecular Formula | C22H17ClFN3O2S |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (2Z,5R)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1[C@@H](Cc2ccc(F)cc2)S/C(=N\N=C/c2ccc(Cl)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C22H17ClFN3O2S/c23-17-7-3-16(4-8-17)13-25-26-22-27(14-19-2-1-11-29-19)21(28)20(30-22)12-15-5-9-18(24)10-6-15/h1-11,13,20H,12,14H2/b25-13-,26-22-/t20-/m1/s1 |
| InChIKey | DCUGRKVJPDVMFU-NVSRCQEDSA-N |
| XLogP | 5.15 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|